Products 2361798-87-8
CAS 2361798-87-8 is the registry number for rac-(1R,6S,7S,8S)-8-Aminobicyclo(4.2.0)octane-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R,6S,7S,8S)-8-aminobicyclo[4.2.0]octane-7-carboxylic acid (CAS 2361798-87-8) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: (1R,6S,7S,8S)-8-aminobicyclo[4.2.0]octane-7-carboxylic acid. InChIKey: CVEGBBSJQUAHNB-YWIQKCBGSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | (1R,6S,7S,8S)-8-aminobicyclo[4.2.0]octane-7-carboxylic acid |
| InChIKey | CVEGBBSJQUAHNB-YWIQKCBGSA-N |
| SMILES | C1CC[C@@H]2[C@H](C1)[C@@H]([C@H]2N)C(=O)O |
Computed by PubChem (NCBI)