Products 2361799-64-4
CAS 2361799-64-4 appears in our catalog under these names: DPTIP (hydrochloride), DPTIP (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10 mg, 5 mg, 1 mg, 25 mg.
2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenol;hydrochloride (CAS 2361799-64-4) is a chemical compound with the molecular formula C21H19ClN2O3S and a molecular weight of 414.9 g/mol. IUPAC name: 2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenol;hydrochloride. InChIKey: JXCSNAONSJHTTR-UHFFFAOYSA-N.
| Molecular formula | C21H19ClN2O3S |
|---|---|
| Molecular weight | 414.9 g/mol |
| IUPAC name | 2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenol;hydrochloride |
| InChIKey | JXCSNAONSJHTTR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)C2=NC(=C(N2)C3=CC=CS3)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)