Products 2361926-15-8
CAS 2361926-15-8 is the registry number for 1,2,3,4-tetrahydroquinoline-3-carboxylic acid, >97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Tert-butyl (3R,4R)-3-amino-4-phenylpyrrolidine-1-carboxylate (CAS 2361926-15-8) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: tert-butyl (3R,4R)-3-amino-4-phenylpyrrolidine-1-carboxylate. InChIKey: UEGLRNLEEDBVTH-STQMWFEESA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-amino-4-phenylpyrrolidine-1-carboxylate |
| InChIKey | UEGLRNLEEDBVTH-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)