CAS 2361988-22-7 is the registry number for Tenofovir disoproxil Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-1-(6-aminopurin-7-yl)propan-2-yl]oxymethylphosphonic acid (CAS 2361988-22-7) is a chemical compound with the molecular formula C9H14N5O4P and a molecular weight of 287.21 g/mol. IUPAC name: [(2R)-1-(6-aminopurin-7-yl)propan-2-yl]oxymethylphosphonic acid. InChIKey: LWTAUMNUETWSFS-ZCFIWIBFSA-N.
| Molecular formula | C9H14N5O4P |
|---|---|
| Molecular weight | 287.21 g/mol |
| IUPAC name | [(2R)-1-(6-aminopurin-7-yl)propan-2-yl]oxymethylphosphonic acid |
| InChIKey | LWTAUMNUETWSFS-ZCFIWIBFSA-N |
| SMILES | C[C@H](CN1C=NC2=NC=NC(=C21)N)OCP(=O)(O)O |
Computed by PubChem (NCBI)