Products 2361988-76-1
CAS 2361988-76-1 is the registry number for cRIPGBM. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-benzyl-1-[(4-fluorophenyl)methyl]-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione chloride (CAS 2361988-76-1) is a chemical compound with the molecular formula C26H20ClFN2O2 and a molecular weight of 446.9 g/mol. IUPAC name: 3-benzyl-1-[(4-fluorophenyl)methyl]-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione chloride. InChIKey: IHNGETPFBJHWFE-UHFFFAOYSA-M.
| Molecular formula | C26H20ClFN2O2 |
|---|---|
| Molecular weight | 446.9 g/mol |
| IUPAC name | 3-benzyl-1-[(4-fluorophenyl)methyl]-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione chloride |
| InChIKey | IHNGETPFBJHWFE-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C2=C(N1CC3=CC=C(C=C3)F)C(=O)C4=CC=CC=C4C2=O)CC5=CC=CC=C5.[Cl-] |
Computed by PubChem (NCBI)