Products 2364493-24-1
CAS 2364493-24-1 is the registry number for Antibacterial agent 105. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-methyl-6-nitro-4-oxo-1,10-phenanthroline-3-carboxylic acid (CAS 2364493-24-1) is a chemical compound with the molecular formula C14H9N3O5 and a molecular weight of 299.24 g/mol. IUPAC name: 1-methyl-6-nitro-4-oxo-1,10-phenanthroline-3-carboxylic acid. InChIKey: RIEAJTBBEGOEKG-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O5 |
|---|---|
| Molecular weight | 299.24 g/mol |
| IUPAC name | 1-methyl-6-nitro-4-oxo-1,10-phenanthroline-3-carboxylic acid |
| InChIKey | RIEAJTBBEGOEKG-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)C2=CC(=C3C=CC=NC3=C21)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)