CAS 938018-07-6 is the registry number for 3-Methyl-6-(4-nitrophenyl)-(1,2)oxazolo(5,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-methyl-6-(4-nitrophenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 938018-07-6) is a chemical compound with the molecular formula C14H9N3O5 and a molecular weight of 299.24 g/mol. IUPAC name: 3-methyl-6-(4-nitrophenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: QIIWOYAOHAQMDU-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O5 |
|---|---|
| Molecular weight | 299.24 g/mol |
| IUPAC name | 3-methyl-6-(4-nitrophenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | QIIWOYAOHAQMDU-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=CC(=N2)C3=CC=C(C=C3)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)