CAS 2364585-33-9 appears in our catalog under these names: 5-(6-Bromo-2,3-dichlorophenyl)oxazole, 95%, 5-(6-bromo-2,3-dichlorophenyl)oxazole, ≥95%, ≥95%, 5-(6-Bromo-2,3-dichlorophenyl)oxazole. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
5-(6-bromo-2,3-dichlorophenyl)-1,3-oxazole (CAS 2364585-33-9) is a chemical compound with the molecular formula C9H4BrCl2NO and a molecular weight of 292.94 g/mol. IUPAC name: 5-(6-bromo-2,3-dichlorophenyl)-1,3-oxazole. InChIKey: CXTZSUHHBQGLRX-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2NO |
|---|---|
| Molecular weight | 292.94 g/mol |
| IUPAC name | 5-(6-bromo-2,3-dichlorophenyl)-1,3-oxazole |
| InChIKey | CXTZSUHHBQGLRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)Cl)C2=CN=CO2)Br |
Computed by PubChem (NCBI)