CAS 2379321-64-7 is the registry number for 5-(4-Bromo-2,6-dichlorophenyl)oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-(4-bromo-2,6-dichlorophenyl)-1,3-oxazole (CAS 2379321-64-7) is a chemical compound with the molecular formula C9H4BrCl2NO and a molecular weight of 292.94 g/mol. IUPAC name: 5-(4-bromo-2,6-dichlorophenyl)-1,3-oxazole. InChIKey: JCZDWORSEZARCE-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2NO |
|---|---|
| Molecular weight | 292.94 g/mol |
| IUPAC name | 5-(4-bromo-2,6-dichlorophenyl)-1,3-oxazole |
| InChIKey | JCZDWORSEZARCE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C2=CN=CO2)Cl)Br |
Computed by PubChem (NCBI)