CAS 2365173-95-9 is the registry number for 3-((4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)piperidine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]piperidine;hydrochloride (CAS 2365173-95-9) is a chemical compound with the molecular formula C12H25BClNO2 and a molecular weight of 261.60 g/mol. IUPAC name: 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]piperidine;hydrochloride. InChIKey: LUPPFWKIBMBDOE-UHFFFAOYSA-N.
| Molecular formula | C12H25BClNO2 |
|---|---|
| Molecular weight | 261.60 g/mol |
| IUPAC name | 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]piperidine;hydrochloride |
| InChIKey | LUPPFWKIBMBDOE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CCCNC2.Cl |
Computed by PubChem (NCBI)