CAS 2379560-96-8 appears in our catalog under these names: 1-Methyl-piperidine-4-boronic acid pinacol ester hydrochloride, 98%, 1-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 1g, 250mg.
1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride (CAS 2379560-96-8) is a chemical compound with the molecular formula C12H25BClNO2 and a molecular weight of 261.60 g/mol. IUPAC name: 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride. InChIKey: ASDRZQBXMYAQJZ-UHFFFAOYSA-N.
| Molecular formula | C12H25BClNO2 |
|---|---|
| Molecular weight | 261.60 g/mol |
| IUPAC name | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride |
| InChIKey | ASDRZQBXMYAQJZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCN(CC2)C.Cl |
Computed by PubChem (NCBI)