CAS 2365418-34-2 appears in our catalog under these names: 5-Bromo-N,2-dimethylnicotinamide, 98+%, 5-Bromo-N,2-dimethylpyridine-3-carboxamide, 98%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
5-bromo-N,2-dimethylpyridine-3-carboxamide (CAS 2365418-34-2) is a chemical compound with the molecular formula C8H9BrN2O and a molecular weight of 229.07 g/mol. IUPAC name: 5-bromo-N,2-dimethylpyridine-3-carboxamide. InChIKey: CWFDFELDMDQBQM-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 5-bromo-N,2-dimethylpyridine-3-carboxamide |
| InChIKey | CWFDFELDMDQBQM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)Br)C(=O)NC |
Computed by PubChem (NCBI)