CAS 2365419-14-1 is the registry number for 2,2-Dimethylpropyl 5-bromopyridine-3-sulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,2-dimethylpropyl 5-bromopyridine-3-sulfonate (CAS 2365419-14-1) is a chemical compound with the molecular formula C10H14BrNO3S and a molecular weight of 308.19 g/mol. IUPAC name: 2,2-dimethylpropyl 5-bromopyridine-3-sulfonate. InChIKey: PQMSYICOMSIZHP-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO3S |
|---|---|
| Molecular weight | 308.19 g/mol |
| IUPAC name | 2,2-dimethylpropyl 5-bromopyridine-3-sulfonate |
| InChIKey | PQMSYICOMSIZHP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)COS(=O)(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)