CAS 296275-38-2 appears in our catalog under these names: 3-Bromo-N-isopropyl-4-methoxybenzenesulfonamide, 98%, 3-Bromo-N-isopropyl-4-methoxybenzenesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
3-bromo-4-methoxy-N-propan-2-ylbenzenesulfonamide (CAS 296275-38-2) is a chemical compound with the molecular formula C10H14BrNO3S and a molecular weight of 308.19 g/mol. IUPAC name: 3-bromo-4-methoxy-N-propan-2-ylbenzenesulfonamide. InChIKey: UEZOQYPXSJVWID-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO3S |
|---|---|
| Molecular weight | 308.19 g/mol |
| IUPAC name | 3-bromo-4-methoxy-N-propan-2-ylbenzenesulfonamide |
| InChIKey | UEZOQYPXSJVWID-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC(=C(C=C1)OC)Br |
Computed by PubChem (NCBI)