Products 2365501-07-9
CAS 2365501-07-9 is the registry number for N1-(3,5-bis(1,1-Dimethylethyl)phenyl)-1,2-Benzenediamine. Offered by: Chemat Brand. Available pack sizes: on request.
2-N-(3,5-ditert-butylphenyl)benzene-1,2-diamine (CAS 2365501-07-9) is a chemical compound with the molecular formula C20H28N2 and a molecular weight of 296.4 g/mol. IUPAC name: 2-N-(3,5-ditert-butylphenyl)benzene-1,2-diamine. InChIKey: DKUPZFASENNFFJ-UHFFFAOYSA-N.
| Molecular formula | C20H28N2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 2-N-(3,5-ditert-butylphenyl)benzene-1,2-diamine |
| InChIKey | DKUPZFASENNFFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)NC2=CC=CC=C2N)C(C)(C)C |
Computed by PubChem (NCBI)