CAS 58519-87-2 is the registry number for rel-(1R,2S)-1,2-dimesitylethane-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine (CAS 58519-87-2) is a chemical compound with the molecular formula C20H28N2 and a molecular weight of 296.4 g/mol. IUPAC name: 1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine. InChIKey: ILMRHFMYIXTNMC-UHFFFAOYSA-N.
| Molecular formula | C20H28N2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine |
| InChIKey | ILMRHFMYIXTNMC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C(C2=C(C=C(C=C2C)C)C)N)N)C |
Computed by PubChem (NCBI)