CAS 2366149-62-2 is the registry number for 6-Bromo-7-methoxy-1,5-naphthyridin-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-7-methoxy-1H-1,5-naphthyridin-4-one (CAS 2366149-62-2) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 6-bromo-7-methoxy-1H-1,5-naphthyridin-4-one. InChIKey: OXJQJNXXKQEHHP-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 6-bromo-7-methoxy-1H-1,5-naphthyridin-4-one |
| InChIKey | OXJQJNXXKQEHHP-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C2C(=O)C=CNC2=C1)Br |
Computed by PubChem (NCBI)