CAS 2366182-58-1 is the registry number for Rel-((2R,6S)-6-cyclopropylmorpholin-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,6S)-6-cyclopropylmorpholin-2-yl]methanol (CAS 2366182-58-1) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: [(2R,6S)-6-cyclopropylmorpholin-2-yl]methanol. InChIKey: NNBLIBYKHJPMHB-HTQZYQBOSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | [(2R,6S)-6-cyclopropylmorpholin-2-yl]methanol |
| InChIKey | NNBLIBYKHJPMHB-HTQZYQBOSA-N |
| SMILES | C1CC1[C@H]2CNC[C@@H](O2)CO |
Computed by PubChem (NCBI)