CAS 2366183-14-2 is the registry number for (S)-N-((6,6-Dimethylmorpholin-2-yl)methyl)methanesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[[(2S)-6,6-dimethylmorpholin-2-yl]methyl]methanesulfonamide (CAS 2366183-14-2) is a chemical compound with the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. IUPAC name: N-[[(2S)-6,6-dimethylmorpholin-2-yl]methyl]methanesulfonamide. InChIKey: REGXJYPOWKETIZ-ZETCQYMHSA-N.
| Molecular formula | C8H18N2O3S |
|---|---|
| Molecular weight | 222.31 g/mol |
| IUPAC name | N-[[(2S)-6,6-dimethylmorpholin-2-yl]methyl]methanesulfonamide |
| InChIKey | REGXJYPOWKETIZ-ZETCQYMHSA-N |
| SMILES | CC1(CNC[C@H](O1)CNS(=O)(=O)C)C |
Computed by PubChem (NCBI)