Products 2367619-63-2
CAS 2367619-63-2 appears in our catalog under these names: TMX-4100, TMX–4100, TMX-4100, 98.18%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 100mg, 25mg, 50mg, 5 mg, 10 mg, 25 mg.
3-(4-thiophen-3-yltriazol-1-yl)piperidine-2,6-dione (CAS 2367619-63-2) is a chemical compound with the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. IUPAC name: 3-(4-thiophen-3-yltriazol-1-yl)piperidine-2,6-dione. InChIKey: PGEUBQZQGXWTFO-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O2S |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 3-(4-thiophen-3-yltriazol-1-yl)piperidine-2,6-dione |
| InChIKey | PGEUBQZQGXWTFO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C=C(N=N2)C3=CSC=C3 |
Computed by PubChem (NCBI)