CAS 510764-58-6 is the registry number for 3-((9H-Benzo[4,5]imidazo[2,1-c][1,2,4]triazol-3-yl)thio)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)propanoic acid (CAS 510764-58-6) is a chemical compound with the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. IUPAC name: 3-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)propanoic acid. InChIKey: IJRZAJPXIICNLX-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O2S |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 3-(3H-[1,2,4]triazolo[4,3-a]benzimidazol-1-ylsulfanyl)propanoic acid |
| InChIKey | IJRZAJPXIICNLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C(=NN3)SCCC(=O)O |
Computed by PubChem (NCBI)