CAS 2368844-09-9 is the registry number for (S)-3-(1-((4-Methyl-4H-1,2,4-triazol-3-yl)thio)ethyl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1S)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]aniline (CAS 2368844-09-9) is a chemical compound with the molecular formula C11H14N4S and a molecular weight of 234.32 g/mol. IUPAC name: 3-[(1S)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]aniline. InChIKey: KUFWECHDRUAAKK-QMMMGPOBSA-N.
| Molecular formula | C11H14N4S |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 3-[(1S)-1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]aniline |
| InChIKey | KUFWECHDRUAAKK-QMMMGPOBSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)N)SC2=NN=CN2C |
Computed by PubChem (NCBI)