Products 725226-96-0
CAS 725226-96-0 appears in our catalog under these names: 5-[3-(Dimethylamino)phenyl]-4-methyl-4h-1,2,4-triazole-3-thiol, 95%, 5-(3-(Dimethylamino)phenyl)-4-methyl-4H-1,2,4-triazole-3-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[3-(dimethylamino)phenyl]-4-methyl-1H-1,2,4-triazole-5-thione (CAS 725226-96-0) is a chemical compound with the molecular formula C11H14N4S and a molecular weight of 234.32 g/mol. IUPAC name: 3-[3-(dimethylamino)phenyl]-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: QSSGFANJYVUEDQ-UHFFFAOYSA-N.
| Molecular formula | C11H14N4S |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 3-[3-(dimethylamino)phenyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | QSSGFANJYVUEDQ-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)C2=CC(=CC=C2)N(C)C |
Computed by PubChem (NCBI)