Products 2368851-60-7
CAS 2368851-60-7 is the registry number for (S)-8-(3-Methoxyphenyl)-9a-phenyl-9,9a-dihydropyrido[1,2-a]indole-6,10-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(9aS)-8-(3-methoxyphenyl)-9a-phenyl-9H-pyrido[1,2-a]indole-6,10-dione (CAS 2368851-60-7) is a chemical compound with the molecular formula C25H19NO3 and a molecular weight of 381.4 g/mol. IUPAC name: (9aS)-8-(3-methoxyphenyl)-9a-phenyl-9H-pyrido[1,2-a]indole-6,10-dione. InChIKey: OMSUSFRVGXYGLY-VWLOTQADSA-N.
| Molecular formula | C25H19NO3 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (9aS)-8-(3-methoxyphenyl)-9a-phenyl-9H-pyrido[1,2-a]indole-6,10-dione |
| InChIKey | OMSUSFRVGXYGLY-VWLOTQADSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=O)N3C4=CC=CC=C4C(=O)[C@]3(C2)C5=CC=CC=C5 |
Computed by PubChem (NCBI)