Products 2368852-38-2
CAS 2368852-38-2 is the registry number for (S)-2-Methoxy-8,9a-diphenyl-9,9a-dihydropyrido[1,2-a]indole-6,10-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(9aS)-2-methoxy-8,9a-diphenyl-9H-pyrido[1,2-a]indole-6,10-dione (CAS 2368852-38-2) is a chemical compound with the molecular formula C25H19NO3 and a molecular weight of 381.4 g/mol. IUPAC name: (9aS)-2-methoxy-8,9a-diphenyl-9H-pyrido[1,2-a]indole-6,10-dione. InChIKey: VWVVSZILMXGASX-VWLOTQADSA-N.
| Molecular formula | C25H19NO3 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (9aS)-2-methoxy-8,9a-diphenyl-9H-pyrido[1,2-a]indole-6,10-dione |
| InChIKey | VWVVSZILMXGASX-VWLOTQADSA-N |
| SMILES | COC1=CC2=C(C=C1)N3C(=O)C=C(C[C@@]3(C2=O)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)