CAS 2368909-53-7 is the registry number for 5-Chloro-6-fluoro-1-tetrahydropyran-2-yl-indazol-4-ol, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
5-chloro-6-fluoro-1-(oxan-2-yl)indazol-4-ol (CAS 2368909-53-7) is a chemical compound with the molecular formula C12H12ClFN2O2 and a molecular weight of 270.69 g/mol. IUPAC name: 5-chloro-6-fluoro-1-(oxan-2-yl)indazol-4-ol. InChIKey: QQRLHRRUJVOCNO-UHFFFAOYSA-N.
| Molecular formula | C12H12ClFN2O2 |
|---|---|
| Molecular weight | 270.69 g/mol |
| IUPAC name | 5-chloro-6-fluoro-1-(oxan-2-yl)indazol-4-ol |
| InChIKey | QQRLHRRUJVOCNO-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=CC(=C(C(=C3C=N2)O)Cl)F |
Computed by PubChem (NCBI)