Products 2857081-39-9
CAS 2857081-39-9 is the registry number for (S)-6-Chloro-5-fluorospiro[benzo[d][1,3]oxazine-4,3'-piperidin]-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-6-chloro-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one (CAS 2857081-39-9) is a chemical compound with the molecular formula C12H12ClFN2O2 and a molecular weight of 270.69 g/mol. IUPAC name: (4S)-6-chloro-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one. InChIKey: JAAWCNFCHYMWHN-GFCCVEGCSA-N.
| Molecular formula | C12H12ClFN2O2 |
|---|---|
| Molecular weight | 270.69 g/mol |
| IUPAC name | (4S)-6-chloro-5-fluorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one |
| InChIKey | JAAWCNFCHYMWHN-GFCCVEGCSA-N |
| SMILES | C1C[C@@]2(CNC1)C3=C(C=CC(=C3F)Cl)NC(=O)O2 |
Computed by PubChem (NCBI)