CAS 2368941-28-8 is the registry number for Pomalidomide-cyclohexane-C-COOH. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-4-yl]acetic acid (CAS 2368941-28-8) is a chemical compound with the molecular formula C20H21N3O6 and a molecular weight of 399.4 g/mol. IUPAC name: 2-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-4-yl]acetic acid. InChIKey: RIJAZNCAEKKDAF-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O6 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 2-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-4-yl]acetic acid |
| InChIKey | RIJAZNCAEKKDAF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)N4CCC(CC4)CC(=O)O |
Computed by PubChem (NCBI)