CAS 5800-34-0 appears in our catalog under these names: N-Glutaryl-L-phenylalanine p-nitroanilide, Glutaryl–Phe–pNA, Glutaryl-Phe-pNA, N-GLUTARYL-L-PHENYLALANINE P, N-GLUTARYL-L-PHENYLALANINE P- &. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 5g, 10g, 25g.
5-[[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]amino]-5-oxopentanoic acid (CAS 5800-34-0) is a chemical compound with the molecular formula C20H21N3O6 and a molecular weight of 399.4 g/mol. IUPAC name: 5-[[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]amino]-5-oxopentanoic acid. InChIKey: LFZGBNATHRHOKZ-KRWDZBQOSA-N.
| Molecular formula | C20H21N3O6 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 5-[[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]amino]-5-oxopentanoic acid |
| InChIKey | LFZGBNATHRHOKZ-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)CCCC(=O)O |
Computed by PubChem (NCBI)