CAS 2370018-58-7 is the registry number for 1-[(2R)-azetidin-2-yl]-N,N-dimethyl-methanamine,2,2,2-trifluoroacetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-[(2R)-azetidin-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) (CAS 2370018-58-7) is a chemical compound with the molecular formula C10H16F6N2O4 and a molecular weight of 342.24 g/mol. IUPAC name: 1-[(2R)-azetidin-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid). InChIKey: XVUDRPYMUJZMHH-QYCVXMPOSA-N.
| Molecular formula | C10H16F6N2O4 |
|---|---|
| Molecular weight | 342.24 g/mol |
| IUPAC name | 1-[(2R)-azetidin-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | XVUDRPYMUJZMHH-QYCVXMPOSA-N |
| SMILES | CN(C)C[C@H]1CCN1.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)