CAS 928025-46-1 is the registry number for (R)-2-Ethylpiperazine bis(2,2,2-trifluoroacetate), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-ethylpiperazine;bis(2,2,2-trifluoroacetic acid) (CAS 928025-46-1) is a chemical compound with the molecular formula C10H16F6N2O4 and a molecular weight of 342.24 g/mol. IUPAC name: (2R)-2-ethylpiperazine;bis(2,2,2-trifluoroacetic acid). InChIKey: PLHLLCCWOPYNKB-QYCVXMPOSA-N.
| Molecular formula | C10H16F6N2O4 |
|---|---|
| Molecular weight | 342.24 g/mol |
| IUPAC name | (2R)-2-ethylpiperazine;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | PLHLLCCWOPYNKB-QYCVXMPOSA-N |
| SMILES | CC[C@@H]1CNCCN1.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)