CAS 237076-57-2 is the registry number for (S)–2–((Methoxycarbonyl)amino)pentanoic acid. Offered by: GLPBio. Available pack sizes: 1g.
(2S)-2-(methoxycarbonylamino)pentanoic acid (CAS 237076-57-2) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. IUPAC name: (2S)-2-(methoxycarbonylamino)pentanoic acid. InChIKey: MUSAWTUYKNDIND-YFKPBYRVSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | (2S)-2-(methoxycarbonylamino)pentanoic acid |
| InChIKey | MUSAWTUYKNDIND-YFKPBYRVSA-N |
| SMILES | CCC[C@@H](C(=O)O)NC(=O)OC |
Computed by PubChem (NCBI)