CAS 2374237-98-4 is the registry number for 3-(4-Bromophenyl)-2,2-difluorobicyclo(1.1.1)pentane-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 100mg.
3-(4-bromophenyl)-2,2-difluorobicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2374237-98-4) is a chemical compound with the molecular formula C12H9BrF2O2 and a molecular weight of 303.10 g/mol. IUPAC name: 3-(4-bromophenyl)-2,2-difluorobicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: KWRNYZVMTCHOJL-UHFFFAOYSA-N.
| Molecular formula | C12H9BrF2O2 |
|---|---|
| Molecular weight | 303.10 g/mol |
| IUPAC name | 3-(4-bromophenyl)-2,2-difluorobicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | KWRNYZVMTCHOJL-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2(F)F)C(=O)O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)