CAS 2791271-62-8 is the registry number for 8-Bromo-1,2-difluoro-6-(methoxymethoxy)naphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-1,2-difluoro-6-(methoxymethoxy)naphthalene (CAS 2791271-62-8) is a chemical compound with the molecular formula C12H9BrF2O2 and a molecular weight of 303.10 g/mol. IUPAC name: 8-bromo-1,2-difluoro-6-(methoxymethoxy)naphthalene. InChIKey: NBXJIYANQOJLAN-UHFFFAOYSA-N.
| Molecular formula | C12H9BrF2O2 |
|---|---|
| Molecular weight | 303.10 g/mol |
| IUPAC name | 8-bromo-1,2-difluoro-6-(methoxymethoxy)naphthalene |
| InChIKey | NBXJIYANQOJLAN-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C2C(=C1)C=CC(=C2F)F)Br |
Computed by PubChem (NCBI)