Products 237427-96-2
CAS 237427-96-2 appears in our catalog under these names: (S)–2–Morpholin–4–yl–propionic acid hydrochloride, (2S)-2-(Morpholin-4-yl)propanoic acid hydrochloride, (S)-2-Morpholin-4-yl-propionic acid hydrochloride, 97%, 97%, (S)-2-Morpholin-4-yl-propionic acid hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
(2S)-2-morpholin-4-ylpropanoic acid;hydrochloride (CAS 237427-96-2) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: (2S)-2-morpholin-4-ylpropanoic acid;hydrochloride. InChIKey: ZKEGDUIFZVBHQV-RGMNGODLSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | (2S)-2-morpholin-4-ylpropanoic acid;hydrochloride |
| InChIKey | ZKEGDUIFZVBHQV-RGMNGODLSA-N |
| SMILES | C[C@@H](C(=O)O)N1CCOCC1.Cl |
Computed by PubChem (NCBI)
Synonyms:
(2S)-2-(Morpholin-4-yl)propanoic acid hydrochloride, (S)-2-Morpholin-4-yl-propionic acid hydrochloride, (S)-2-Morpholinopropanoic Acid Hydrochloride, (2S)-2-morpholin-4-ylpropanoic acid;hydrochloride, (2S)-2-morpholinopropanoic acid;hydrochloride, (S)-2-Morpholin-4-yl-propionicacidhydrochloride