CAS 237429-61-7 is the registry number for 2–(hydroxymethyl)–3H–benzimidazole–5–carbonitrile. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-(hydroxymethyl)-3H-benzimidazole-5-carbonitrile (CAS 237429-61-7) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: 2-(hydroxymethyl)-3H-benzimidazole-5-carbonitrile. InChIKey: ICYYSGGLERPRGT-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 2-(hydroxymethyl)-3H-benzimidazole-5-carbonitrile |
| InChIKey | ICYYSGGLERPRGT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NC(=N2)CO |
Computed by PubChem (NCBI)