Products 2375016-11-6
CAS 2375016-11-6 is the registry number for 5,10-Di(pyridin-4-yl)-5,10-dihydrophenazine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5,10-dipyridin-4-ylphenazine (CAS 2375016-11-6) is a chemical compound with the molecular formula C22H16N4 and a molecular weight of 336.4 g/mol. IUPAC name: 5,10-dipyridin-4-ylphenazine. InChIKey: OOAKDESBUZFWAH-UHFFFAOYSA-N.
| Molecular formula | C22H16N4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 5,10-dipyridin-4-ylphenazine |
| InChIKey | OOAKDESBUZFWAH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3N2C4=CC=NC=C4)C5=CC=NC=C5 |
Computed by PubChem (NCBI)