Products 1807547-41-6
CAS 1807547-41-6 is the registry number for (E)-4,4'-(2-(Phenyldiazenyl)-1,4-phenylene)dipyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,5-dipyridin-4-ylphenyl)-phenyldiazene (CAS 1807547-41-6) is a chemical compound with the molecular formula C22H16N4 and a molecular weight of 336.4 g/mol. IUPAC name: (2,5-dipyridin-4-ylphenyl)-phenyldiazene. InChIKey: FLPICFKQBFDOEY-UHFFFAOYSA-N.
| Molecular formula | C22H16N4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (2,5-dipyridin-4-ylphenyl)-phenyldiazene |
| InChIKey | FLPICFKQBFDOEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=C(C=CC(=C2)C3=CC=NC=C3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)