Products 1872218-35-3
CAS 1872218-35-3 appears in our catalog under these names: (E)-1,2-Bis(4-(pyridin-4-yl)phenyl)diazene, 95%, 95%, (E)-1,2-Bis(4-(pyridin-4-yl)phenyl)diazene, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Bis(4-pyridin-4-ylphenyl)diazene (CAS 1872218-35-3) is a chemical compound with the molecular formula C22H16N4 and a molecular weight of 336.4 g/mol. IUPAC name: bis(4-pyridin-4-ylphenyl)diazene. InChIKey: PAIAQILEEWPFDR-UHFFFAOYSA-N.
| Molecular formula | C22H16N4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | bis(4-pyridin-4-ylphenyl)diazene |
| InChIKey | PAIAQILEEWPFDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)N=NC3=CC=C(C=C3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)