Products 2375042-31-0
CAS 2375042-31-0 is the registry number for TCR-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[4-(4-fluorophenyl)-3-(pyrrolidin-1-ylmethyl)-2H-chromen-6-yl]oxy]propanoic acid (CAS 2375042-31-0) is a chemical compound with the molecular formula C23H24FNO4 and a molecular weight of 397.4 g/mol. IUPAC name: 3-[[4-(4-fluorophenyl)-3-(pyrrolidin-1-ylmethyl)-2H-chromen-6-yl]oxy]propanoic acid. InChIKey: XXARLKNSPVBUSQ-UHFFFAOYSA-N.
| Molecular formula | C23H24FNO4 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 3-[[4-(4-fluorophenyl)-3-(pyrrolidin-1-ylmethyl)-2H-chromen-6-yl]oxy]propanoic acid |
| InChIKey | XXARLKNSPVBUSQ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=C(C3=C(C=CC(=C3)OCCC(=O)O)OC2)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)