CAS 2451176-31-9 is the registry number for (3R,5S,E)-7-(1-Ethyl-3-(4-fluorophenyl)-1H-indol-2-yl)-3,5-dihydroxyhept-6-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E,3R,5S)-7-[1-ethyl-3-(4-fluorophenyl)indol-2-yl]-3,5-dihydroxyhept-6-enoic acid (CAS 2451176-31-9) is a chemical compound with the molecular formula C23H24FNO4 and a molecular weight of 397.4 g/mol. IUPAC name: (E,3R,5S)-7-[1-ethyl-3-(4-fluorophenyl)indol-2-yl]-3,5-dihydroxyhept-6-enoic acid. InChIKey: HGUPDLZHYDGKGB-LLSOJIOMSA-N.
| Molecular formula | C23H24FNO4 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | (E,3R,5S)-7-[1-ethyl-3-(4-fluorophenyl)indol-2-yl]-3,5-dihydroxyhept-6-enoic acid |
| InChIKey | HGUPDLZHYDGKGB-LLSOJIOMSA-N |
| SMILES | CCN1C2=CC=CC=C2C(=C1/C=C/[C@H](C[C@H](CC(=O)O)O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)