CAS 2375089-01-1 appears in our catalog under these names: Palbociclib Impurity 46, 8-Cyclopentyl-5-methylpyrido[2,3-d]pyrimidine-2,7(1H,8H)-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-cyclopentyl-5-methyl-1H-pyrido[2,3-d]pyrimidine-2,7-dione (CAS 2375089-01-1) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: 8-cyclopentyl-5-methyl-1H-pyrido[2,3-d]pyrimidine-2,7-dione. InChIKey: WITUAFNZNWBREC-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 8-cyclopentyl-5-methyl-1H-pyrido[2,3-d]pyrimidine-2,7-dione |
| InChIKey | WITUAFNZNWBREC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C2=C1C=NC(=O)N2)C3CCCC3 |
Computed by PubChem (NCBI)