CAS 2375165-64-1 is the registry number for tert-Butyl ((3R,5R)-5-(difluoromethyl)piperidin-3-yl)carbamate, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(3R,5R)-5-(difluoromethyl)piperidin-3-yl]carbamate (CAS 2375165-64-1) is a chemical compound with the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. IUPAC name: tert-butyl N-[(3R,5R)-5-(difluoromethyl)piperidin-3-yl]carbamate. InChIKey: ATHHDYBFMRSHLU-HTQZYQBOSA-N.
| Molecular formula | C11H20F2N2O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | tert-butyl N-[(3R,5R)-5-(difluoromethyl)piperidin-3-yl]carbamate |
| InChIKey | ATHHDYBFMRSHLU-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](CNC1)C(F)F |
Computed by PubChem (NCBI)