Products 2375193-32-9
CAS 2375193-32-9 appears in our catalog under these names: 5-Aminobicyclo[3.1.1]heptane-1-carboxylic acid hydrochloride, 98%, 98%, 5-Aminobicyclo[3.1.1]heptane-1-carboxylic acid hydrochloride, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-aminobicyclo[3.1.1]heptane-1-carboxylic acid;hydrochloride (CAS 2375193-32-9) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: 5-aminobicyclo[3.1.1]heptane-1-carboxylic acid;hydrochloride. InChIKey: KTWIDGJWUVCLRY-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 5-aminobicyclo[3.1.1]heptane-1-carboxylic acid;hydrochloride |
| InChIKey | KTWIDGJWUVCLRY-UHFFFAOYSA-N |
| SMILES | C1CC2(CC(C1)(C2)N)C(=O)O.Cl |
Computed by PubChem (NCBI)