Products 2375247-58-6
CAS 2375247-58-6 is the registry number for rac-(1R,2S,4R,5R)-5-Amino-2-methylbicyclo(2.2.1)heptan-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 25mg, 0,25g.
(1S,2R,4S,5S)-5-amino-2-methylbicyclo[2.2.1]heptan-2-ol;hydrochloride (CAS 2375247-58-6) is a chemical compound with the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. IUPAC name: (1S,2R,4S,5S)-5-amino-2-methylbicyclo[2.2.1]heptan-2-ol;hydrochloride. InChIKey: NLTRGWCRNHCONQ-MCHYRWFDSA-N.
| Molecular formula | C8H16ClNO |
|---|---|
| Molecular weight | 177.67 g/mol |
| IUPAC name | (1S,2R,4S,5S)-5-amino-2-methylbicyclo[2.2.1]heptan-2-ol;hydrochloride |
| InChIKey | NLTRGWCRNHCONQ-MCHYRWFDSA-N |
| SMILES | C[C@]1(C[C@@H]2C[C@H]1C[C@@H]2N)O.Cl |
Computed by PubChem (NCBI)