CAS 2375248-75-0 is the registry number for (3AR,6aS)-hexahydro-2H-pyrrolo(3,4-d)oxazol-2-one hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 10g, 100mg, 1g, 5g.
(3aR,6aS)-3,3a,4,5,6,6a-hexahydropyrrolo[3,4-d][1,3]oxazol-2-one;hydrochloride (CAS 2375248-75-0) is a chemical compound with the molecular formula C5H9ClN2O2 and a molecular weight of 164.59 g/mol. IUPAC name: (3aR,6aS)-3,3a,4,5,6,6a-hexahydropyrrolo[3,4-d][1,3]oxazol-2-one;hydrochloride. InChIKey: FGDGMCOFWFWQNY-HJXLNUONSA-N.
| Molecular formula | C5H9ClN2O2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | (3aR,6aS)-3,3a,4,5,6,6a-hexahydropyrrolo[3,4-d][1,3]oxazol-2-one;hydrochloride |
| InChIKey | FGDGMCOFWFWQNY-HJXLNUONSA-N |
| SMILES | C1[C@@H]2[C@H](CN1)OC(=O)N2.Cl |
Computed by PubChem (NCBI)