CAS 1801140-47-5 appears in our catalog under these names: D–2–Aminoglutarimide (hydrochloride), (R)-3-Aminopiperidine-2,6-dione hydrochloride, 95%, D-2-Aminoglutarimide (hydrochloride), D-2-Aminoglutarimide HCl 96%, (R)-3-Aminopiperidine-2,6-dione hydrochloride, 95%, 95%. Offered by: GLPBio, Combi-blocks, TargetMol, Ambeed, Chemat. Available pack sizes: 5mg, 250mg, 1g, 1mg, 10mg, 5g, 10g, 25g.
(3R)-3-aminopiperidine-2,6-dione;hydrochloride (CAS 1801140-47-5) is a chemical compound with the molecular formula C5H9ClN2O2 and a molecular weight of 164.59 g/mol. IUPAC name: (3R)-3-aminopiperidine-2,6-dione;hydrochloride. InChIKey: YCPULGHBTPQLRH-AENDTGMFSA-N.
| Molecular formula | C5H9ClN2O2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | (3R)-3-aminopiperidine-2,6-dione;hydrochloride |
| InChIKey | YCPULGHBTPQLRH-AENDTGMFSA-N |
| SMILES | C1CC(=O)NC(=O)[C@@H]1N.Cl |
Computed by PubChem (NCBI)