Products 2375249-36-6
CAS 2375249-36-6 is the registry number for ((3S,5R)-3-(Aminomethyl)-4,5-dimethylmorpholin-3-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(3S,5R)-3-(aminomethyl)-4,5-dimethylmorpholin-3-yl]methanol (CAS 2375249-36-6) is a chemical compound with the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. IUPAC name: [(3S,5R)-3-(aminomethyl)-4,5-dimethylmorpholin-3-yl]methanol. InChIKey: OVWDDWGDLFUOTL-SFYZADRCSA-N.
| Molecular formula | C8H18N2O2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | [(3S,5R)-3-(aminomethyl)-4,5-dimethylmorpholin-3-yl]methanol |
| InChIKey | OVWDDWGDLFUOTL-SFYZADRCSA-N |
| SMILES | C[C@@H]1COC[C@](N1C)(CN)CO |
Computed by PubChem (NCBI)