CAS 2375250-57-8 is the registry number for Methyl (2R)-2-(2-aminoacetamido)-3-(4-hydroxyphenyl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl (2R)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride (CAS 2375250-57-8) is a chemical compound with the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. IUPAC name: methyl (2R)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: IPOMLJRDALKBAM-HNCPQSOCSA-N.
| Molecular formula | C12H17ClN2O4 |
|---|---|
| Molecular weight | 288.73 g/mol |
| IUPAC name | methyl (2R)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | IPOMLJRDALKBAM-HNCPQSOCSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)O)NC(=O)CN.Cl |
Computed by PubChem (NCBI)