CAS 934587-44-7 is the registry number for 3-(Cbz-amino)-D-alanine methyl ester HCl, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl (2R)-2-amino-3-(phenylmethoxycarbonylamino)propanoate;hydrochloride (CAS 934587-44-7) is a chemical compound with the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. IUPAC name: methyl (2R)-2-amino-3-(phenylmethoxycarbonylamino)propanoate;hydrochloride. InChIKey: SWVHIRLJXPQBCI-HNCPQSOCSA-N.
| Molecular formula | C12H17ClN2O4 |
|---|---|
| Molecular weight | 288.73 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(phenylmethoxycarbonylamino)propanoate;hydrochloride |
| InChIKey | SWVHIRLJXPQBCI-HNCPQSOCSA-N |
| SMILES | COC(=O)[C@@H](CNC(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)